![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| PHRM 1002 Pharmacy Calculations.doc | 2016-11-22 19:42 | 49K | |
| PHRM 1001 Pharmacology.doc | 2016-11-22 19:42 | 49K | |
| PHRM 1000 Orientation to Pharmacy Tech.doc | 2016-11-22 19:42 | 47K | |
| PHRM 1003 Pharmacy Operations.doc | 2016-11-22 19:42 | 44K | |
| PHRM 1005 Pharmacy Technician Internship.doc | 2016-11-22 19:42 | 43K | |
| PHRM 1005 Pharmacy Technician Internship.docx | 2021-05-18 20:36 | 20K | |
| PHRM 1002 Pharmacy Calculations.docx | 2021-05-18 20:36 | 20K | |
| PHRM 1006 Advanced Pharmacy Operations.docx | 2021-05-18 20:36 | 19K | |
| PHRM 1003 Pharmacy Operations.docx | 2021-05-18 20:36 | 18K | |
| PHRM 1004 Pharmacy Technician Topics.docx | 2021-05-18 20:36 | 17K | |
| PHRM 1000 Orientation to Pharmacy Technician.docx | 2021-05-18 20:36 | 17K | |
| PHRM 1001 Pharmacology.docx | 2021-05-18 20:36 | 17K | |