![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1 CBRN Program and roles.pptx | 2025-12-26 20:43 | 25M | |
| Day 2c PATS Mask and MOPP.ppt | 2021-02-13 13:11 | 445K | |
| Day 2b chemical agent detection equipment.ppt | 2021-02-13 13:11 | 1.3M | |
| Day 1b Biological Operations.ppt | 2021-02-13 13:11 | 634K | |
| Day 1a Characteristics of Chemical Agents.ppt | 2021-02-13 13:10 | 4.0M | |
| Day 4 Survey recon Decon.pptx | 2018-07-26 15:54 | 1.2M | |
| Day 3 CBRN Reports.pptx | 2016-10-03 15:05 | 1.3M | |
| Day 3+4a NBC Reports.pptx | 2015-04-21 15:35 | 544K | |
| M4 JCAD Class.pptx | 2011-10-31 12:18 | 10M | |
| Thorough Decon Mission.ppt | 2009-05-13 10:39 | 338K | |
| React to Chemical-Bio Attack.ppt | 2009-05-13 10:28 | 62K | |