![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | #17 Comm Bank Rep 10.03.2018 EP.pdf | 2018-12-07 17:21 | 353K | |
| #18 Personal Banker II EP.pdf | 2018-03-01 15:52 | 297K | |
| ABCC.pdf | 2024-04-17 19:54 | 620K | |
| ABCO Wire Manager Position.pdf | 2023-03-09 17:26 | 159K | |
| ACS Food Service Manager Ellsworth.pdf | 2016-11-22 19:41 | 255K | |
| ASM Posting-Central Kansas-9-22-23_.pdf | 2023-09-25 14:30 | 113K | |
| Aarons CSR.pdf | 2016-11-22 19:41 | 163K | |
| Aarons Delivery Driver.pdf | 2016-11-22 19:41 | 424K | |
| Aarons Manager Trainee.pdf | 2016-11-22 19:41 | 206K | |
| Administrative Customer Service Associate.pdf | 2019-01-17 21:15 | 132K | |
| Agco Technician .pdf | 2016-11-22 19:41 | 163K | |
| Agronomy Applicator Posting.pdf | 2024-02-06 21:14 | 448K | |
| Aircraft Mechanic.pdf | 2016-11-22 19:41 | 208K | |
| Aviands position.pdf | 2016-11-22 19:41 | 179K | |
| Barton Co Learning Academy.pdf | 2016-11-22 19:41 | 55K | |
| Barton Co Prog Analyst Hiring Poster w QR code_9.6.24.pdf | 2024-08-27 17:12 | 462K | |
![[ ]](/icons/unknown.gif) | BartonFSAtemp.doc | 2016-11-22 19:41 | 27K | |
| Bioproduction Operator.pdf | 2019-01-17 21:15 | 108K | |
| Bling MIT.pdf | 2020-01-02 19:18 | 75K | |
| Boardwalk Pipeline Partners.pdf | 2019-01-17 21:15 | 224K | |
| Branch Manager.pdf | 2018-02-19 15:02 | 109K | |
| CUNA Operations Generalist II.pdf | 2016-11-22 19:41 | 107K | |
| Capital Markets Accounting Specialist (002).pdf | 2023-09-12 13:42 | 135K | |
| Chemical Operator I.pdf | 2022-02-11 16:18 | 38K | |
| Chemical Technician I.pdf | 2022-02-11 16:18 | 140K | |
| Citizens Medical Center.pdf | 2016-11-22 19:41 | 589K | |
| City of Salina 09-22-2017 .pdf | 2017-09-26 18:59 | 132K | |
| Classified Position Application USD 431.pdf | 2017-05-24 15:14 | 188K | |
| CloudCo Hlth Ctr.pdf | 2016-11-22 19:41 | 165K | |
| Combined Insurance Sales Agent.pdf | 2016-11-22 19:41 | 22K | |
| Combined Insurance Sales Agent Pt2.pdf | 2016-11-22 19:41 | 22K | |
| Community Development Coordinator Rice County.pdf | 2016-11-22 19:41 | 26K | |
| Corrosion Control Technician - JD.pdf | 2022-03-23 18:52 | 469K | |
| Corrosion Specialist Kansas Gas Service.pdf | 2018-01-18 17:20 | 197K | |
| Craig HomeCare.pdf | 2018-05-23 17:53 | 317K | |
| Credit Admin ad 6-2015.pdf | 2016-11-22 19:41 | 82K | |
| DCCCCA Nursing.pdf | 2016-11-22 19:41 | 274K | |
| Detention officer.pdf | 2016-12-01 16:27 | 350K | |
| Director of Dining Services.pdf | 2016-11-22 19:41 | 99K | |
| DollarTree.pdf | 2016-11-22 19:41 | 220K | |
| ECMC job list March 15.pdf | 2016-11-22 19:41 | 12K | |
| EMT Job Announcement.pdf | 2016-11-22 19:41 | 344K | |
| Eaton.pdf | 2016-11-22 19:41 | 111K | |
| Ellinwood Hospital_23.pdf | 2023-02-17 16:46 | 147K | |
| Ellsworth Coop Chemical Applicator.pdf | 2019-02-18 21:56 | 174K | |
| Ellsworth County Medical Center.pdf | 2016-11-22 19:41 | 102K | |
| Emergency Vehicle Technician - Job Posting.pdf | 2019-05-21 16:59 | 31K | |
| Equipment Mechanic.pdf | 2019-01-17 22:17 | 206K | |
| Extra-board Firefighter.pdf | 2016-11-22 19:41 | 485K | |
| ExxonMobil.pdf | 2016-11-22 19:41 | 264K | |
| FC Case Mgr.pdf | 2016-11-22 19:41 | 148K | |
| FC Correct Off.pdf | 2016-11-22 19:41 | 149K | |
| FHSU Ad March 2022 With workday link.pdf | 2022-03-11 19:24 | 82K | |
| Farmers New Accts rep.pdf | 2016-11-22 19:41 | 294K | |
| Field Engineer.pdf | 2016-11-22 19:41 | 419K | |
| Field Service Technician I.pdf | 2024-05-22 15:54 | 209K | |
| Firefigher Flyer PDF.pdf | 2018-11-08 15:52 | 644K | |
| Full Time Position.pdf | 2019-01-17 22:17 | 201K | |
| Fuller Senior Accountant.pdf | 2017-10-16 15:28 | 148K | |
| Fuller_Project Specialist_2016.pdf | 2016-11-22 19:41 | 45K | |
| Fusion Bank Larned 2022.10.pdf | 2022-10-26 19:35 | 41K | |
| GBCF Executive Director Position Profile FINAL.pdf | 2023-11-02 14:13 | 131K | |
| GB Industries HRGen.pdf | 2022-01-12 14:31 | 266K | |
| GB Tribune.pdf | 2016-11-22 19:41 | 454K | |
| GB regional.pdf | 2016-11-22 19:41 | 147K | |
| Golden Belt Feeders.pdf | 2016-11-22 19:41 | 170K | |
| Great Bend Industries.docx | 2016-11-22 19:41 | 3.4M | |
| Hamilton Co Hosp.pdf | 2016-11-22 19:41 | 171K | |
| Haysmed.pdf | 2019-07-30 14:21 | 607K | |
| Heartland Ag.pdf | 2018-02-01 14:30 | 343K | |
| IT Specialist.pdf | 2019-09-26 14:30 | 94K | |
| IT Support Technician Redbarn.pdf | 2019-03-20 14:07 | 423K | |
| Job-description-Scale Tech.pdf | 2016-11-22 19:41 | 23K | |
| Job Announcement - Utility Forester - Kansas City MO Topeka KS Overland Park KS.pdf | 2021-06-08 12:29 | 231K | |
| Jomax-Payroll Clerk Job Description.pdf | 2018-08-31 20:51 | 309K | |
| KAKE Account Executive GB.pdf | 2016-11-22 19:41 | 153K | |
| KS Pathology.pdf | 2016-11-22 19:41 | 185K | |
| KS wetlands temp.pdf | 2016-11-22 19:41 | 221K | |
| Keenan.pdf | 2019-06-03 19:09 | 24K | |
| Koch Help Desk .pdf | 2017-12-06 20:00 | 277K | |
| Laugh N' Learn.pdf | 2016-11-22 19:41 | 44K | |
| Lawrence PD.pdf | 2016-11-22 19:41 | 415K | |
| Lending Operations Processor - Larned.pdf | 2022-02-03 18:04 | 155K | |
| Lending Operations Processor - Pratt.pdf | 2022-02-03 18:04 | 154K | |
| Life Enrichment Director.pdf | 2016-11-22 19:41 | 177K | |
| MLT Norton.pdf | 2016-11-22 19:41 | 128K | |
| MMTC - Kansas Recruitment Post.pdf | 2017-07-25 19:35 | 145K | |
| MPI F15.pdf | 2016-11-22 19:41 | 108K | |
| MPI ft and pt SP16.pdf | 2016-11-22 19:41 | 110K | |
| MPI security.pdf | 2016-11-22 19:41 | 108K | |
| Master Fleet Mechanic Short Job Posting.pdf | 2019-05-01 13:57 | 30K | |
| Measurement -Technician Job Posting.pdf | 2016-11-22 19:41 | 95K | |
| Measurement Technician Colby Position.pdf | 2019-06-11 20:35 | 96K | |
| Medical Billing .pdf | 2018-07-13 18:59 | 205K | |
| Mid Continent Controls Bench Technician .pdf | 2016-11-22 19:41 | 209K | |
| Mutual FAD F15.pdf | 2016-11-22 19:41 | 181K | |
| NNG1.pdf | 2018-08-31 13:29 | 916K | |
| NNG2.pdf | 2018-08-31 13:29 | 903K | |
| NORTHWESTERN ENERGY.pdf | 2018-01-18 16:26 | 175K | |
| Nestle USA - CDL B Route Sales Representative - Hays KS.pdf | 2019-01-18 19:37 | 657K | |
| NexTech systems Engineer.pdf | 2016-11-22 19:41 | 198K | |
| OCHC2017 Ad.pdf | 2017-06-19 12:48 | 518K | |
| OCHC RN and CNA.pdf | 2017-01-23 15:30 | 386K | |
| Ottawa County.pdf | 2016-11-22 19:41 | 110K | |
| Primus 22.pdf | 2022-02-03 17:57 | 50K | |
| Primus drafting tech.pdf | 2016-11-22 19:41 | 260K | |
| Programmer .pdf | 2016-11-22 19:41 | 202K | |
| RBPP- Recruiting Onboarding Specialist.pdf | 2019-10-08 13:24 | 599K | |
| Redbarn - Training Clerk Job Posting.pdf | 2022-02-15 16:46 | 425K | |
| Redbarn F16.pdf | 2016-11-22 19:41 | 887K | |
| Redbarn Manager_Company Trainer.pdf | 2016-11-22 19:41 | 222K | |
| Russell CPA Firm.pdf | 2016-11-22 19:41 | 132K | |
| Safety Manager.pdf | 2018-05-29 12:00 | 114K | |
| ScribeAmerica.pdf | 2016-11-22 19:41 | 39K | |
| Senior_Bookkeeper- 2019.pdf | 2019-07-22 13:09 | 518K | |
| Service Coordinator.pdf | 2016-11-22 19:41 | 421K | |
| Smith County Memorial.pdf | 2016-11-22 19:41 | 81K | |
| Sunflower Div Accounting Clerk.pdf | 2016-11-22 19:41 | 91K | |
| Superior Essex Summer.pdf | 2018-05-04 13:42 | 32K | |
| Superior Essex System Support Specialist (shared services 2016).pdf | 2021-04-20 21:30 | 158K | |
| TSA PT Flyer.pdf | 2016-11-22 19:41 | 616K | |
| Treasurer_20220321.pdf | 2023-01-06 16:48 | 189K | |
| University Police Lieutenant v2.pdf | 2022-03-16 17:33 | 89K | |
| Utility Forester.pdf | 2019-08-02 20:42 | 423K | |
| Utiltiy Forester in kansas City MO Overland Park KS.pdf | 2021-06-08 12:24 | 374K | |
| Viaro wireless.pdf | 2016-11-22 19:41 | 249K | |
| Watco conductor engineer.pdf | 2016-11-22 19:41 | 112K | |
| Watkins Calcara - legal assistant (002).pdf | 2023-03-15 14:02 | 26K | |
| Watkins Calcara - legal assistant.pdf | 2023-03-14 21:30 | 27K | |
| Watkins LEGAL.pdf | 2023-10-05 17:20 | 62K | |
| Wheatridge.pdf | 2016-11-22 19:41 | 186K | |
| YesCare hiring Flyer_Topeka KS.pdf | 2022-06-13 12:10 | 120K | |
| accounting-coordinator0115.pdf | 2016-11-22 19:41 | 74K | |
| ad-mechanical-designer.pdf | 2016-11-22 19:41 | 69K | |
| adminassistant-gb.pdf | 2016-11-22 19:41 | 273K | |
| asst-tech-specialist.pdf | 2016-11-22 19:41 | 4.4K | |
| at-and-t.pdf | 2016-11-22 19:41 | 192K | |
| axtell-clinic-lpn.pdf | 2016-11-22 19:41 | 204K | |
| barton-fsa-temp.pdf | 2016-11-22 19:41 | 72K | |
| career-center-employer-web-post-request-form2014.pdf | 2016-11-22 19:41 | 188K | |
| cdi-hs-south-central-kansas-job-advertisement.pdf | 2016-11-22 19:41 | 176K | |
| certified-coder020314.pdf | 2016-11-22 19:41 | 32K | |
| cnc-ii.pdf | 2016-11-22 19:41 | 256K | |
| controls-technician.pdf | 2016-11-22 19:41 | 49K | |
| ellsworth childcare director.pdf | 2016-11-22 19:41 | 179K | |
| finadvmutualomaha.pdf | 2016-11-22 19:41 | 188K | |
| firefighter.pdf | 2016-11-22 19:41 | 2.0M | |
| full-time-farmhand.pdf | 2016-11-22 19:41 | 107K | |
| gbi5-22.pdf | 2016-11-22 19:41 | 205K | |
| insurance-agent-opportunity.pdf | 2016-11-22 19:41 | 66K | |
| job-flier-just-farm.pdf | 2016-11-22 19:41 | 93K | |
| konzaprairiechc.pdf | 2016-11-22 19:41 | 454K | |
| ks-corporate-security-officer.pdf | 2016-11-22 19:41 | 130K | |
| kstate ext 2017.pdf | 2017-03-08 19:38 | 108K | |
| laborer-grain.pdf | 2020-05-12 15:28 | 166K | |
| lang-diesel.pdf | 2016-11-22 19:41 | 334K | |
| larned-state-hospitol-rns-lpns.pdf | 2016-11-22 19:41 | 211K | |
| lincoln-ne-police.pdf | 2016-11-22 19:41 | 50K | |
| maico-industries.pdf | 2019-01-11 18:45 | 61K | |
| maico.pdf | 2019-02-28 21:11 | 61K | |
| medtechcnas-12-04-13-2.pdf | 2016-11-22 19:41 | 72K | |
| medtechcnas-12-04-13.pdf | 2016-11-22 19:41 | 72K | |
| missouri-med-positions.pdf | 2016-11-22 19:41 | 92K | |
| mutualofomaha.pdf | 2016-11-22 19:41 | 175K | |
| northern-natural-gas.pdf | 2016-11-22 19:41 | 122K | |
| operation-specialist-job-post.pdf | 2016-11-22 19:41 | 100K | |
| paraprofessional-boy-scouts-public-post.pdf | 2016-11-22 19:41 | 220K | |
| preschool-teacher-hays.pdf | 2016-11-22 19:41 | 143K | |
| quality-renovations.pdf | 2016-11-22 19:41 | 100K | |
| scan.pdf | 2016-11-22 19:41 | 50K | |
| scotts-lawncare.pdf | 2016-11-22 19:41 | 62K | |
| solidworks-drafter.pdf | 2016-11-22 19:41 | 27K | |
| sundivfa14.pdf | 2016-11-22 19:41 | 35K | |
| tcmfgaccountclerk.pdf | 2016-11-22 19:41 | 31K | |
| weathercraft.pdf | 2016-11-22 19:41 | 139K | |
| wilson-telephone-company-inc.pdf | 2016-11-22 19:41 | 98K | |
|
|---|